C16H16N2O — CID 134925657
(2Z)-2-[(2Z,4E,6E)-7-phenylhepta-2,4,6-trienylidene]-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134925657) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (2Z)-2-[(2Z,4E,6E)-7-phenylhepta-2,4,6-trienylidene]-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-[(2Z,4E,6E)-7-phenylhepta-2,4,6-trienylidene]-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134925657 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (2Z)-2-[(2Z,4E,6E)-7-phenylhepta-2,4,6-trienylidene]-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N/[N+](=C\C=C/C=C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C16H16N2O/c19-16-12-14-18(17-16)13-8-3-1-2-5-9-15-10-6-4-7-11-15/h1-11,13H,12,14H2/b2-1+,8-3-,9-5+,18-13- |
| InChIKey | RITNDRDOALDKLI-FZXDRGIZSA-N |
| XLogP | 1.97 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|