C20H20N2O — CID 134925659
(2Z)-2-[(2Z,4E,6E,8E,10E)-11-phenylundeca-2,4,6,8,10-pentaenylidene]-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134925659) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is (2Z)-2-[(2Z,4E,6E,8E,10E)-11-phenylundeca-2,4,6,8,10-pentaenylidene]-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-[(2Z,4E,6E,8E,10E)-11-phenylundeca-2,4,6,8,10-pentaenylidene]-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134925659 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2Z)-2-[(2Z,4E,6E,8E,10E)-11-phenylundeca-2,4,6,8,10-pentaenylidene]-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N/[N+](=C\C=C/C=C/C=C/C=C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C20H20N2O/c23-20-16-18-22(21-20)17-12-7-5-3-1-2-4-6-9-13-19-14-10-8-11-15-19/h1-15,17H,16,18H2/b2-1+,5-3+,6-4+,12-7-,13-9+,22-17- |
| InChIKey | YSKAOXCBUNEFFN-RODBAJGFSA-N |
| XLogP | 3.09 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|