C20H24N2O — CID 134925684
(2Z,4S)-4-hexyl-2-(naphthalen-2-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134925684) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (2Z,4S)-4-hexyl-2-(naphthalen-2-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z,4S)-4-hexyl-2-(naphthalen-2-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134925684 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (2Z,4S)-4-hexyl-2-(naphthalen-2-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | CCCCCC[C@H]1C/[N+](=C/c2ccc3ccccc3c2)N=C1[O-] |
| InChI | InChI=1S/C20H24N2O/c1-2-3-4-5-10-19-15-22(21-20(19)23)14-16-11-12-17-8-6-7-9-18(17)13-16/h6-9,11-14,19H,2-5,10,15H2,1H3/b22-14-/t19-/m0/s1 |
| InChIKey | IVDYYZAXUTZOER-MAGMUUGSSA-N |
| XLogP | 3.55 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|