C22H18N2O — CID 134924561
(1Z)-5,5-dimethyl-1-(pyren-4-ylmethylidene)-4H-pyrazol-1-ium-3-olate (PubChem CID 134924561) has the molecular formula C22H18N2O and a molecular weight of 326.40 g/mol. Its IUPAC name is (1Z)-5,5-dimethyl-1-(pyren-4-ylmethylidene)-4H-pyrazol-1-ium-3-olate.
| Compound Name | (1Z)-5,5-dimethyl-1-(pyren-4-ylmethylidene)-4H-pyrazol-1-ium-3-olate |
|---|---|
| PubChem CID | 134924561 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (1Z)-5,5-dimethyl-1-(pyren-4-ylmethylidene)-4H-pyrazol-1-ium-3-olate |
| SMILES | CC1(C)CC([O-])=N/[N+]1=C\c1cc2cccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C22H18N2O/c1-22(2)12-19(25)23-24(22)13-17-11-16-7-3-5-14-9-10-15-6-4-8-18(17)21(15)20(14)16/h3-11,13H,12H2,1-2H3/b24-13- |
| InChIKey | XUQRFHMJABHHQA-CFRMEGHHSA-N |
| XLogP | 3.87 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|