C15H20N2O — CID 15505754
(1Z)-5,5-dimethyl-1-[(2,4,6-trimethylphenyl)methylidene]-4H-pyrazol-1-ium-3-olate (PubChem CID 15505754) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (1Z)-5,5-dimethyl-1-[(2,4,6-trimethylphenyl)methylidene]-4H-pyrazol-1-ium-3-olate.
| Compound Name | (1Z)-5,5-dimethyl-1-[(2,4,6-trimethylphenyl)methylidene]-4H-pyrazol-1-ium-3-olate |
|---|---|
| PubChem CID | 15505754 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (1Z)-5,5-dimethyl-1-[(2,4,6-trimethylphenyl)methylidene]-4H-pyrazol-1-ium-3-olate |
| SMILES | Cc1cc(C)c(/C=[N+]2\N=C([O-])CC2(C)C)c(C)c1 |
| InChI | InChI=1S/C15H20N2O/c1-10-6-11(2)13(12(3)7-10)9-17-15(4,5)8-14(18)16-17/h6-7,9H,8H2,1-5H3/b17-9- |
| InChIKey | LUTHZXFZDJTLDP-MFOYZWKCSA-N |
| XLogP | 1.90 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|