C16H16N2O — CID 135078921
(1Z)-5,5-dimethyl-1-(naphthalen-2-ylmethylidene)-4H-pyrazol-1-ium-3-olate (PubChem CID 135078921) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (1Z)-5,5-dimethyl-1-(naphthalen-2-ylmethylidene)-4H-pyrazol-1-ium-3-olate.
| Compound Name | (1Z)-5,5-dimethyl-1-(naphthalen-2-ylmethylidene)-4H-pyrazol-1-ium-3-olate |
|---|---|
| PubChem CID | 135078921 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (1Z)-5,5-dimethyl-1-(naphthalen-2-ylmethylidene)-4H-pyrazol-1-ium-3-olate |
| SMILES | CC1(C)CC([O-])=N/[N+]1=C\c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H16N2O/c1-16(2)10-15(19)17-18(16)11-12-7-8-13-5-3-4-6-14(13)9-12/h3-9,11H,10H2,1-2H3/b18-11- |
| InChIKey | GCRYDBSDODRSRR-WQRHYEAKSA-N |
| XLogP | 2.13 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|