C26H26N2O — CID 134925256
(2Z,4S)-4-hexyl-2-(pyren-4-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134925256) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is (2Z,4S)-4-hexyl-2-(pyren-4-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z,4S)-4-hexyl-2-(pyren-4-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134925256 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2Z,4S)-4-hexyl-2-(pyren-4-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | CCCCCC[C@H]1C/[N+](=C/c2cc3cccc4ccc5cccc2c5c43)N=C1[O-] |
| InChI | InChI=1S/C26H26N2O/c1-2-3-4-5-8-21-16-28(27-26(21)29)17-22-15-20-11-6-9-18-13-14-19-10-7-12-23(22)25(19)24(18)20/h6-7,9-15,17,21H,2-5,8,16H2,1H3/b28-17-/t21-/m0/s1 |
| InChIKey | BOJNPFCTIXUJMS-LQULIRLISA-N |
| XLogP | 5.29 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|