C18H19F3N2O — CID 71578463
(1Z)-5,5-dimethyl-1-[[2-pent-1-ynyl-5-(trifluoromethyl)phenyl]methylidene]-4H-pyrazol-1-ium-3-olate (PubChem CID 71578463) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is (1Z)-5,5-dimethyl-1-[[2-pent-1-ynyl-5-(trifluoromethyl)phenyl]methylidene]-4H-pyrazol-1-ium-3-olate.
| Compound Name | (1Z)-5,5-dimethyl-1-[[2-pent-1-ynyl-5-(trifluoromethyl)phenyl]methylidene]-4H-pyrazol-1-ium-3-olate |
|---|---|
| PubChem CID | 71578463 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (1Z)-5,5-dimethyl-1-[[2-pent-1-ynyl-5-(trifluoromethyl)phenyl]methylidene]-4H-pyrazol-1-ium-3-olate |
| SMILES | CCCC#Cc1ccc(C(F)(F)F)cc1/C=[N+]1\N=C([O-])CC1(C)C |
| InChI | InChI=1S/C18H19F3N2O/c1-4-5-6-7-13-8-9-15(18(19,20)21)10-14(13)12-23-17(2,3)11-16(24)22-23/h8-10,12H,4-5,11H2,1-3H3/b23-12- |
| InChIKey | MBRUTZGTMQKCDH-FMCGGJTJSA-N |
| XLogP | 3.14 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|