C16H14N2O — CID 135076445
(2Z,3S)-2-benzylidene-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 135076445) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is (2Z,3S)-2-benzylidene-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z,3S)-2-benzylidene-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 135076445 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2Z,3S)-2-benzylidene-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N/[N+](=C\c2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H14N2O/c19-16-11-15(14-9-5-2-6-10-14)18(17-16)12-13-7-3-1-4-8-13/h1-10,12,15H,11H2/b18-12-/t15-/m0/s1 |
| InChIKey | HXZWRXNYEMAPSJ-BRYHAGSVSA-N |
| XLogP | 1.94 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|