C17H13F3N2O — CID 16658258
(2Z)-3-phenyl-2-[[3-(trifluoromethyl)phenyl]methylidene]-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 16658258) has the molecular formula C17H13F3N2O and a molecular weight of 318.30 g/mol. Its IUPAC name is (2Z)-3-phenyl-2-[[3-(trifluoromethyl)phenyl]methylidene]-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-3-phenyl-2-[[3-(trifluoromethyl)phenyl]methylidene]-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 16658258 |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2Z)-3-phenyl-2-[[3-(trifluoromethyl)phenyl]methylidene]-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N/[N+](=C\c2cccc(C(F)(F)F)c2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H13F3N2O/c18-17(19,20)14-8-4-5-12(9-14)11-22-15(10-16(23)21-22)13-6-2-1-3-7-13/h1-9,11,15H,10H2/b22-11- |
| InChIKey | VQADZZGCLAFWLS-JJFYIABZSA-N |
| XLogP | 2.96 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|