C16H20N2O — CID 177423845
(2Z)-2-(cyclohexylmethylidene)-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 177423845) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (2Z)-2-(cyclohexylmethylidene)-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-(cyclohexylmethylidene)-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 177423845 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (2Z)-2-(cyclohexylmethylidene)-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N/[N+](=C\C2CCCCC2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H20N2O/c19-16-11-15(14-9-5-2-6-10-14)18(17-16)12-13-7-3-1-4-8-13/h2,5-6,9-10,12-13,15H,1,3-4,7-8,11H2/b18-12- |
| InChIKey | OIWKBFYTKGHQGA-PDGQHHTCSA-N |
| XLogP | 2.47 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|