C19H22O4S — CID 134878859
(6S)-2-(benzenesulfonyl)-6-(phenylmethoxymethyl)oxane (PubChem CID 134878859) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is (6S)-2-(benzenesulfonyl)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (6S)-2-(benzenesulfonyl)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 134878859 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (6S)-2-(benzenesulfonyl)-6-(phenylmethoxymethyl)oxane |
| SMILES | O=S(=O)(c1ccccc1)C1CCC[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C19H22O4S/c20-24(21,18-11-5-2-6-12-18)19-13-7-10-17(23-19)15-22-14-16-8-3-1-4-9-16/h1-6,8-9,11-12,17,19H,7,10,13-15H2/t17-,19?/m0/s1 |
| InChIKey | TUMLXHCFKHZEIT-KKFHFHRHSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |