C22H24ClN3O — CID 134880170
(E)-1-[2-[(E)-N-anilino-C-methylcarbonimidoyl]piperidin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one (PubChem CID 134880170) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is (E)-1-[2-[(E)-N-anilino-C-methylcarbonimidoyl]piperidin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-[(E)-N-anilino-C-methylcarbonimidoyl]piperidin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 134880170 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (E)-1-[2-[(E)-N-anilino-C-methylcarbonimidoyl]piperidin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one |
| SMILES | C/C(=N\Nc1ccccc1)C1CCCCN1C(=O)/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C22H24ClN3O/c1-17(24-25-19-10-3-2-4-11-19)21-13-7-8-16-26(21)22(27)15-14-18-9-5-6-12-20(18)23/h2-6,9-12,14-15,21,25H,7-8,13,16H2,1H3/b15-14+,24-17+ |
| InChIKey | WGOGQRQMQDHWET-CHLZUDKUSA-N |
| XLogP | 5.22 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|