About zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene
zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene (PubChem CID 134880393) has the molecular formula C26H28OZn
and a molecular weight of 421.90 g/mol. Its IUPAC name is zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene.
Molecular Properties
| Compound Name | zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene |
| PubChem CID | 134880393 |
| Molecular Formula | C26H28OZn |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene |
| SMILES | [CH3-].[H]/[C-]=C\CCCCOC(c1ccccc1)(c1ccccc1)c1ccccc1.[Zn+2] |
| InChI | InChI=1S/C25H25O.CH3.Zn/c1-2-3-4-14-21-26-25(22-15-8-5-9-16-22,23-17-10-6-11-18-23)24-19-12-7-13-20-24;;/h1-2,5-13,15-20H,3-4,14,21H2;1H3;/q2*-1;+2 |
| InChIKey | OPSFFFRTERXXDC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene?
The IUPAC name of zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene (CID 134880393) is zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene.
What is the SMILES notation for zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene?
The canonical SMILES for zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene is [CH3-].[H]/[C-]=C\CCCCOC(c1ccccc1)(c1ccccc1)c1ccccc1.[Zn+2].
What is the InChIKey of zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene?
The InChIKey is OPSFFFRTERXXDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25O.CH3.Zn/c1-2-3-4-14-21-26-25(22-15-8-5-9-16-22,23-17-10-6-11-18-23)24-19-12-7-13-20-24;;/h1-2,5-13,15-20H,3-4,14,21H2;1H3;/q2*-1;+2.
What are the key properties of zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene?
zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene has a molecular weight of 421.90 g/mol, XLogP of 6.60, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;carbanide;[hex-5-enoxy(diphenyl)methyl]benzene is sourced from PubChem (CID 134880393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).