C21H30N2O3S — CID 134881198
N-[(3S)-3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]hex-5-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 134881198) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-[(3S)-3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]hex-5-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-[(3S)-3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]hex-5-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 134881198 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-[(3S)-3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]hex-5-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CC[C@@H](CCN(CC=C)S(=O)(=O)c1ccc(C)cc1)C1=N[C@H](CC)CO1 |
| InChI | InChI=1S/C21H30N2O3S/c1-5-8-18(21-22-19(7-3)16-26-21)13-15-23(14-6-2)27(24,25)20-11-9-17(4)10-12-20/h5-6,9-12,18-19H,1-2,7-8,13-16H2,3-4H3/t18-,19+/m0/s1 |
| InChIKey | JVPGLGNLMXKHAV-RBUKOAKNSA-N |
| XLogP | 3.96 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|