C20H29NO6Si — CID 134882721
(2S,3R,4R)-3-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxopyrrolidine-2-carboxylic acid (PubChem CID 134882721) has the molecular formula C20H29NO6Si and a molecular weight of 407.54 g/mol. Its IUPAC name is (2S,3R,4R)-3-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxopyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,4R)-3-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134882721 |
| Molecular Formula | C20H29NO6Si |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (2S,3R,4R)-3-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxopyrrolidine-2-carboxylic acid |
| SMILES | C[C@H]1C(=O)N[C@](CO[Si](C)(C)C(C)(C)C)(C(=O)O)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H29NO6Si/c1-13-15(27-17(23)14-10-8-7-9-11-14)20(18(24)25,21-16(13)22)12-26-28(5,6)19(2,3)4/h7-11,13,15H,12H2,1-6H3,(H,21,22)(H,24,25)/t13-,15-,20+/m1/s1 |
| InChIKey | VHXFNMDRBBSEOH-RCDCFZSISA-N |
| XLogP | 2.82 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|