C26H30FNO8 — CID 134883551
(2S,3R,4S,5R)-4-[fluoro-[(2S,3R,4S,5R)-3-hydroxy-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]amino]-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 134883551) has the molecular formula C26H30FNO8 and a molecular weight of 503.52 g/mol. Its IUPAC name is (2S,3R,4S,5R)-4-[fluoro-[(2S,3R,4S,5R)-3-hydroxy-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]amino]-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (2S,3R,4S,5R)-4-[fluoro-[(2S,3R,4S,5R)-3-hydroxy-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]amino]-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 134883551 |
| Molecular Formula | C26H30FNO8 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | (2S,3R,4S,5R)-4-[fluoro-[(2S,3R,4S,5R)-3-hydroxy-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]amino]-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | O[C@@H]1[C@H](N(F)[C@@H]2[C@@H]3OCC(O3)[C@@H](OCc3ccccc3)[C@@H]2O)[C@@H]2OCC(O2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H30FNO8/c27-28(19-21(29)23(17-13-33-25(19)35-17)31-11-15-7-3-1-4-8-15)20-22(30)24(18-14-34-26(20)36-18)32-12-16-9-5-2-6-10-16/h1-10,17-26,29-30H,11-14H2/t17?,18?,19-,20-,21+,22+,23+,24+,25+,26+/m0/s1 |
| InChIKey | RTQIUEIQHFHKMB-LMYBWDTPSA-N |
| XLogP | 1.31 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|