C24H33NO6 — CID 134883893
N-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(4-methyl-1-phenylpent-1-yn-3-yl)hydroxylamine (PubChem CID 134883893) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is N-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(4-methyl-1-phenylpent-1-yn-3-yl)hydroxylamine.
| Compound Name | N-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(4-methyl-1-phenylpent-1-yn-3-yl)hydroxylamine |
|---|---|
| PubChem CID | 134883893 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | N-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(4-methyl-1-phenylpent-1-yn-3-yl)hydroxylamine |
| SMILES | CC(C)C(C#Cc1ccccc1)N(O)C1O[C@H]([C@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C24H33NO6/c1-15(2)17(13-12-16-10-8-7-9-11-16)25(26)22-21-20(30-24(5,6)31-21)19(28-22)18-14-27-23(3,4)29-18/h7-11,15,17-22,26H,14H2,1-6H3/t17?,18-,19-,20+,21+,22?/m1/s1 |
| InChIKey | NPXFWFITNSPLOS-QRZRZQRGSA-N |
| XLogP | 3.15 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|