C38H60O9Si2 — CID 134885094
dimethyl (1S,4S,5S,6R,8R,11R,12R,14S,15R)-6-methyl-7-oxo-4-phenylmethoxy-12,14-bis(triethylsilyloxy)-3-oxatetracyclo[6.6.1.01,5.011,15]pentadecane-4,11-dicarboxylate (PubChem CID 134885094) has the molecular formula C38H60O9Si2 and a molecular weight of 717.06 g/mol. Its IUPAC name is dimethyl (1S,4S,5S,6R,8R,11R,12R,14S,15R)-6-methyl-7-oxo-4-phenylmethoxy-12,14-bis(triethylsilyloxy)-3-oxatetracyclo[6.6.1.01,5.011,15]pentadecane-4,11-dicarboxylate.
| Compound Name | dimethyl (1S,4S,5S,6R,8R,11R,12R,14S,15R)-6-methyl-7-oxo-4-phenylmethoxy-12,14-bis(triethylsilyloxy)-3-oxatetracyclo[6.6.1.01,5.011,15]pentadecane-4,11-dicarboxylate |
|---|---|
| PubChem CID | 134885094 |
| Molecular Formula | C38H60O9Si2 |
| Molecular Weight | 717.06 g/mol |
| Exact Mass | 716.38 |
| IUPAC Name | dimethyl (1S,4S,5S,6R,8R,11R,12R,14S,15R)-6-methyl-7-oxo-4-phenylmethoxy-12,14-bis(triethylsilyloxy)-3-oxatetracyclo[6.6.1.01,5.011,15]pentadecane-4,11-dicarboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@H](O[Si](CC)(CC)CC)[C@@]2(C(=O)OC)CC[C@H]3C(=O)[C@H](C)[C@@H]4[C@@](OCc5ccccc5)(C(=O)OC)OC[C@@]14[C@@H]32 |
| InChI | InChI=1S/C38H60O9Si2/c1-10-48(11-2,12-3)46-29-23-30(47-49(13-4,14-5)15-6)37-25-45-38(35(41)43-9,44-24-27-19-17-16-18-20-27)32(37)26(7)31(39)28-21-22-36(29,33(28)37)34(40)42-8/h16-20,26,28-30,32-33H,10-15,21-25H2,1-9H3/t26-,28-,29+,30-,32-,33-,36-,37+,38-/m0/s1 |
| InChIKey | UOBFODRXWDYGTO-UPJFJQEXSA-N |
| XLogP | 7.29 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.06 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|