C41H62O9Si2 — CID 134885165
dimethyl (1S,4S,5R,8R,11R,12R,14S,15R)-6-methyl-4-phenylmethoxy-7-prop-2-ynoxy-12,14-bis(triethylsilyloxy)-3-oxatetracyclo[6.6.1.01,5.011,15]pentadec-6-ene-4,11-dicarboxylate (PubChem CID 134885165) has the molecular formula C41H62O9Si2 and a molecular weight of 755.11 g/mol. Its IUPAC name is dimethyl (1S,4S,5R,8R,11R,12R,14S,15R)-6-methyl-4-phenylmethoxy-7-prop-2-ynoxy-12,14-bis(triethylsilyloxy)-3-oxatetracyclo[6.6.1.01,5.011,15]pentadec-6-ene-4,11-dicarboxylate.
| Compound Name | dimethyl (1S,4S,5R,8R,11R,12R,14S,15R)-6-methyl-4-phenylmethoxy-7-prop-2-ynoxy-12,14-bis(triethylsilyloxy)-3-oxatetracyclo[6.6.1.01,5.011,15]pentadec-6-ene-4,11-dicarboxylate |
|---|---|
| PubChem CID | 134885165 |
| Molecular Formula | C41H62O9Si2 |
| Molecular Weight | 755.11 g/mol |
| Exact Mass | 754.39 |
| IUPAC Name | dimethyl (1S,4S,5R,8R,11R,12R,14S,15R)-6-methyl-4-phenylmethoxy-7-prop-2-ynoxy-12,14-bis(triethylsilyloxy)-3-oxatetracyclo[6.6.1.01,5.011,15]pentadec-6-ene-4,11-dicarboxylate |
| SMILES | C#CCOC1=C(C)[C@@H]2[C@@](OCc3ccccc3)(C(=O)OC)OC[C@@]23[C@@H](O[Si](CC)(CC)CC)C[C@@H](O[Si](CC)(CC)CC)[C@@]2(C(=O)OC)CC[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C41H62O9Si2/c1-11-25-46-34-29(8)35-40(28-48-41(35,38(43)45-10)47-27-30-21-19-18-20-22-30)33(50-52(15-5,16-6)17-7)26-32(49-51(12-2,13-3)14-4)39(37(42)44-9)24-23-31(34)36(39)40/h1,18-22,31-33,35-36H,12-17,23-28H2,2-10H3/t31-,32+,33-,35-,36-,39-,40+,41-/m0/s1 |
| InChIKey | DWQHLKXTPNJTKF-PTGRCFKISA-N |
| XLogP | 8.01 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.11 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|