C19H28Si — CID 134885157
(5-ethynyl-6-methylhept-5-en-1,3-diynyl)-tri(propan-2-yl)silane (PubChem CID 134885157) has the molecular formula C19H28Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (5-ethynyl-6-methylhept-5-en-1,3-diynyl)-tri(propan-2-yl)silane.
| Compound Name | (5-ethynyl-6-methylhept-5-en-1,3-diynyl)-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134885157 |
| Molecular Formula | C19H28Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (5-ethynyl-6-methylhept-5-en-1,3-diynyl)-tri(propan-2-yl)silane |
| SMILES | C#CC(C#CC#C[Si](C(C)C)(C(C)C)C(C)C)=C(C)C |
| InChI | InChI=1S/C19H28Si/c1-10-19(15(2)3)13-11-12-14-20(16(4)5,17(6)7)18(8)9/h1,16-18H,2-9H3 |
| InChIKey | FADPPWLSCWUHNS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|