About bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene
bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene (PubChem CID 134885175) has the molecular formula C18H10Cu2
and a molecular weight of 353.37 g/mol. Its IUPAC name is bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene.
Molecular Properties
| Compound Name | bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene |
| PubChem CID | 134885175 |
| Molecular Formula | C18H10Cu2 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene |
| SMILES | [C-]#Cc1ccccc1/C=C/c1ccccc1C#[C-].[Cu+].[Cu+] |
| InChI | InChI=1S/C18H10.2Cu/c1-3-15-9-5-7-11-17(15)13-14-18-12-8-6-10-16(18)4-2;;/h5-14H;;/q-2;2*+1/b14-13+;; |
| InChIKey | BJCCGTZVDXTQKD-QDBORUFSSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene?
The IUPAC name of bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene (CID 134885175) is bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene.
What is the SMILES notation for bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene?
The canonical SMILES for bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene is [C-]#Cc1ccccc1/C=C/c1ccccc1C#[C-].[Cu+].[Cu+].
What is the InChIKey of bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene?
The InChIKey is BJCCGTZVDXTQKD-QDBORUFSSA-N. The full InChI is InChI=1S/C18H10.2Cu/c1-3-15-9-5-7-11-17(15)13-14-18-12-8-6-10-16(18)4-2;;/h5-14H;;/q-2;2*+1/b14-13+;;.
What are the key properties of bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene?
bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene has a molecular weight of 353.37 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(copper(1+));1-ethynyl-2-[(E)-2-(2-ethynylphenyl)ethenyl]benzene is sourced from PubChem (CID 134885175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).