C25H58ClFN2O6P2 — CID 134885520
[chloro-fluoro-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate;bis(tributylazanium) (PubChem CID 134885520) has the molecular formula C25H58ClFN2O6P2 and a molecular weight of 599.15 g/mol. Its IUPAC name is [chloro-fluoro-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate;bis(tributylazanium).
| Compound Name | [chloro-fluoro-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate;bis(tributylazanium) |
|---|---|
| PubChem CID | 134885520 |
| Molecular Formula | C25H58ClFN2O6P2 |
| Molecular Weight | 599.15 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | [chloro-fluoro-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate;bis(tributylazanium) |
| SMILES | CCCC[NH+](CCCC)CCCC.CCCC[NH+](CCCC)CCCC.O=P([O-])(O)C(F)(Cl)P(=O)([O-])O |
| InChI | InChI=1S/2C12H27N.CH4ClFO6P2/c2*1-4-7-10-13(11-8-5-2)12-9-6-3;2-1(3,10(4,5)6)11(7,8)9/h2*4-12H2,1-3H3;(H2,4,5,6)(H2,7,8,9) |
| InChIKey | PUSRLUPTCDFTQC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.15 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|