C23H36 — CID 134886637
2-[(3E,7E)-3,7-dimethyldodeca-3,7-dien-11-ynyl]-1,3,3-trimethylcyclohexene (PubChem CID 134886637) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is 2-[(3E,7E)-3,7-dimethyldodeca-3,7-dien-11-ynyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(3E,7E)-3,7-dimethyldodeca-3,7-dien-11-ynyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 134886637 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 2-[(3E,7E)-3,7-dimethyldodeca-3,7-dien-11-ynyl]-1,3,3-trimethylcyclohexene |
| SMILES | C#CCC/C=C(\C)CC/C=C(\C)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H36/c1-7-8-9-12-19(2)13-10-14-20(3)16-17-22-21(4)15-11-18-23(22,5)6/h1,12,14H,8-11,13,15-18H2,2-6H3/b19-12+,20-14+ |
| InChIKey | JHDJYSXMWQNVTM-LCAIAVFMSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|