About bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane
bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane (PubChem CID 134886773) has the molecular formula C12H25BrOSiZn
and a molecular weight of 358.71 g/mol. Its IUPAC name is bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane.
Molecular Properties
| Compound Name | bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane |
| PubChem CID | 134886773 |
| Molecular Formula | C12H25BrOSiZn |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane |
| SMILES | C/[C-]=C\[C@@H](C)CO[Si](C)(C)C(C)(C)C.[Zn+]Br |
| InChI | InChI=1S/C12H25OSi.BrH.Zn/c1-8-9-11(2)10-13-14(6,7)12(3,4)5;;/h9,11H,10H2,1-7H3;1H;/q-1;;+2/p-1/t11-;;/m1../s1 |
| InChIKey | ORYQIVUJFCMGBO-NVJADKKVSA-M |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane?
The IUPAC name of bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane (CID 134886773) is bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane.
What is the SMILES notation for bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane?
The canonical SMILES for bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane is C/[C-]=C\[C@@H](C)CO[Si](C)(C)C(C)(C)C.[Zn+]Br.
What is the InChIKey of bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane?
The InChIKey is ORYQIVUJFCMGBO-NVJADKKVSA-M. The full InChI is InChI=1S/C12H25OSi.BrH.Zn/c1-8-9-11(2)10-13-14(6,7)12(3,4)5;;/h9,11H,10H2,1-7H3;1H;/q-1;;+2/p-1/t11-;;/m1../s1.
What are the key properties of bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane?
bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane has a molecular weight of 358.71 g/mol, XLogP of 4.87, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromozinc(1+);tert-butyl-dimethyl-[(2R)-2-methylpent-3-enoxy]silane is sourced from PubChem (CID 134886773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).