C15H28Br2OSi — CID 24777960
tert-butyl-[(2R,3Z)-7,7-dibromo-2,4-dimethylhepta-3,6-dienoxy]-dimethylsilane (PubChem CID 24777960) has the molecular formula C15H28Br2OSi and a molecular weight of 412.28 g/mol. Its IUPAC name is tert-butyl-[(2R,3Z)-7,7-dibromo-2,4-dimethylhepta-3,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3Z)-7,7-dibromo-2,4-dimethylhepta-3,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 24777960 |
| Molecular Formula | C15H28Br2OSi |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | tert-butyl-[(2R,3Z)-7,7-dibromo-2,4-dimethylhepta-3,6-dienoxy]-dimethylsilane |
| SMILES | C/C(=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C)CC=C(Br)Br |
| InChI | InChI=1S/C15H28Br2OSi/c1-12(8-9-14(16)17)10-13(2)11-18-19(6,7)15(3,4)5/h9-10,13H,8,11H2,1-7H3/b12-10-/t13-/m1/s1 |
| InChIKey | GZGKRTNFXCPZTL-KXXVWKPMSA-N |
| XLogP | 6.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|