C11H22Br2OSi — CID 10428447
tert-butyl-[(2R)-4,4-dibromo-2-methylbut-3-enoxy]-dimethylsilane (PubChem CID 10428447) has the molecular formula C11H22Br2OSi and a molecular weight of 358.19 g/mol. Its IUPAC name is tert-butyl-[(2R)-4,4-dibromo-2-methylbut-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-4,4-dibromo-2-methylbut-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10428447 |
| Molecular Formula | C11H22Br2OSi |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | tert-butyl-[(2R)-4,4-dibromo-2-methylbut-3-enoxy]-dimethylsilane |
| SMILES | C[C@H](C=C(Br)Br)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H22Br2OSi/c1-9(7-10(12)13)8-14-15(5,6)11(2,3)4/h7,9H,8H2,1-6H3/t9-/m1/s1 |
| InChIKey | NZQJJNXKDABHFQ-SECBINFHSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|