C27H36O3S — CID 134886892
(1S,2R,5R,7R,8R,10R,11S,15S)-14-(benzenesulfonylmethyl)-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-ene (PubChem CID 134886892) has the molecular formula C27H36O3S and a molecular weight of 440.65 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,10R,11S,15S)-14-(benzenesulfonylmethyl)-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-ene.
| Compound Name | (1S,2R,5R,7R,8R,10R,11S,15S)-14-(benzenesulfonylmethyl)-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-ene |
|---|---|
| PubChem CID | 134886892 |
| Molecular Formula | C27H36O3S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | (1S,2R,5R,7R,8R,10R,11S,15S)-14-(benzenesulfonylmethyl)-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-ene |
| SMILES | CO[C@@H]1C[C@H]2[C@@H]3CC=C(CS(=O)(=O)c4ccccc4)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3C[C@]312 |
| InChI | InChI=1S/C27H36O3S/c1-25-13-12-23-21(15-24(30-3)27-16-18(27)11-14-26(23,27)2)22(25)10-9-19(25)17-31(28,29)20-7-5-4-6-8-20/h4-9,18,21-24H,10-17H2,1-3H3/t18-,21+,22+,23+,24-,25-,26-,27+/m1/s1 |
| InChIKey | ONCRIXWVUIUKAH-CTJNUPIHSA-N |
| XLogP | 5.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|