C22H30O2Si — CID 134886990
(1S)-1-[tert-butyl(dimethyl)silyl]oxy-1,4-diphenylbutan-2-one (PubChem CID 134886990) has the molecular formula C22H30O2Si and a molecular weight of 354.57 g/mol. Its IUPAC name is (1S)-1-[tert-butyl(dimethyl)silyl]oxy-1,4-diphenylbutan-2-one.
| Compound Name | (1S)-1-[tert-butyl(dimethyl)silyl]oxy-1,4-diphenylbutan-2-one |
|---|---|
| PubChem CID | 134886990 |
| Molecular Formula | C22H30O2Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (1S)-1-[tert-butyl(dimethyl)silyl]oxy-1,4-diphenylbutan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C(=O)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30O2Si/c1-22(2,3)25(4,5)24-21(19-14-10-7-11-15-19)20(23)17-16-18-12-8-6-9-13-18/h6-15,21H,16-17H2,1-5H3/t21-/m0/s1 |
| InChIKey | ISFUQAKRYATBRS-NRFANRHFSA-N |
| XLogP | 5.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|