C15H31BrO2Si2Zn — CID 134887088
bromozinc(1+);tert-butyl-dimethyl-(4-trimethylsilyloxycyclohex-2-en-1-yl)oxysilane (PubChem CID 134887088) has the molecular formula C15H31BrO2Si2Zn and a molecular weight of 444.88 g/mol. Its IUPAC name is bromozinc(1+);tert-butyl-dimethyl-(4-trimethylsilyloxycyclohex-2-en-1-yl)oxysilane.
| Compound Name | bromozinc(1+);tert-butyl-dimethyl-(4-trimethylsilyloxycyclohex-2-en-1-yl)oxysilane |
|---|---|
| PubChem CID | 134887088 |
| Molecular Formula | C15H31BrO2Si2Zn |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | bromozinc(1+);tert-butyl-dimethyl-(4-trimethylsilyloxycyclohex-2-en-1-yl)oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=[C-]C(O[Si](C)(C)C)CC1.[Zn+]Br |
| InChI | InChI=1S/C15H31O2Si2.BrH.Zn/c1-15(2,3)19(7,8)17-14-11-9-13(10-12-14)16-18(4,5)6;;/h12-14H,9,11H2,1-8H3;1H;/q-1;;+2/p-1 |
| InChIKey | VYHLDKOETBAPHL-UHFFFAOYSA-M |
| XLogP | 5.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|