C32H66BrO2PSi — CID 134887262
(E,4R,6S,7R,8S)-1-[bromo(tributyl)-λ5-phosphanyl]-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyldec-2-en-5-one (PubChem CID 134887262) has the molecular formula C32H66BrO2PSi and a molecular weight of 621.84 g/mol. Its IUPAC name is (E,4R,6S,7R,8S)-1-[bromo(tributyl)-λ5-phosphanyl]-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyldec-2-en-5-one.
| Compound Name | (E,4R,6S,7R,8S)-1-[bromo(tributyl)-λ5-phosphanyl]-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyldec-2-en-5-one |
|---|---|
| PubChem CID | 134887262 |
| Molecular Formula | C32H66BrO2PSi |
| Molecular Weight | 621.84 g/mol |
| Exact Mass | 620.38 |
| IUPAC Name | (E,4R,6S,7R,8S)-1-[bromo(tributyl)-λ5-phosphanyl]-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyldec-2-en-5-one |
| SMILES | CCCCP(Br)(CCCC)(CCCC)C/C(C)=C/[C@@H](C)C(=O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C32H66BrO2PSi/c1-14-18-21-36(33,22-19-15-2,23-20-16-3)25-26(5)24-28(7)30(34)29(8)31(27(6)17-4)35-37(12,13)32(9,10)11/h24,27-29,31H,14-23,25H2,1-13H3/b26-24+/t27-,28+,29+,31+/m0/s1 |
| InChIKey | CCLXEDYRFFOHLG-YYUAIKLGSA-N |
| XLogP | 11.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.84 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|