C9H14O2 — CID 134888610
(5R,6S)-5,6-dimethoxy-1-methylcyclohexa-1,3-diene (PubChem CID 134888610) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (5R,6S)-5,6-dimethoxy-1-methylcyclohexa-1,3-diene.
| Compound Name | (5R,6S)-5,6-dimethoxy-1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 134888610 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (5R,6S)-5,6-dimethoxy-1-methylcyclohexa-1,3-diene |
| SMILES | CO[C@@H]1C=CC=C(C)[C@@H]1OC |
| InChI | InChI=1S/C9H14O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6,8-9H,1-3H3/t8-,9+/m1/s1 |
| InChIKey | TWOZVOMGDJYORC-BDAKNGLRSA-N |
| XLogP | 1.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |