About [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate
[(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate (PubChem CID 54452049) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate.
Analyze [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate?
The IUPAC name of [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate (CID 54452049) is [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate.
What is the SMILES notation for [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate?
The canonical SMILES for [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate is CC(=O)O[C@@H]1C=CC=C(C)[C@@H]1OC(C)=O.
What is the InChIKey of [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate?
The InChIKey is WVPQAFJZEOIEIR-MNOVXSKESA-N. The full InChI is InChI=1S/C11H14O4/c1-7-5-4-6-10(14-8(2)12)11(7)15-9(3)13/h4-6,10-11H,1-3H3/t10-,11+/m1/s1.
What are the key properties of [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate?
[(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate has a molecular weight of 210.23 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,6S)-6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl] acetate is sourced from PubChem (CID 54452049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).