About [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate
[(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate (PubChem CID 5325690) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate.
Molecular Properties
| Compound Name | [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate |
| PubChem CID | 5325690 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=CC=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H12O4/c1-7(11)13-9-5-3-4-6-10(9)14-8(2)12/h3-6,9-10H,1-2H3/t9-,10+ |
| InChIKey | DFRWRKNLEYOLTM-AOOOYVTPSA-N |
| XLogP | 0.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate?
The IUPAC name of [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate (CID 5325690) is [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate.
What is the SMILES notation for [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate?
The canonical SMILES for [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate is CC(=O)O[C@H]1C=CC=C[C@H]1OC(C)=O.
What is the InChIKey of [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate?
The InChIKey is DFRWRKNLEYOLTM-AOOOYVTPSA-N. The full InChI is InChI=1S/C10H12O4/c1-7(11)13-9-5-3-4-6-10(9)14-8(2)12/h3-6,9-10H,1-2H3/t9-,10+.
What are the key properties of [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate?
[(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate has a molecular weight of 196.20 g/mol, XLogP of 0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,6S)-6-acetyloxycyclohexa-2,4-dien-1-yl] acetate is sourced from PubChem (CID 5325690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).