C19H26O5Si — CID 134889405
dimethyl (1S,2R,7R,8S)-1-trimethylsilyloxytricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate (PubChem CID 134889405) has the molecular formula C19H26O5Si and a molecular weight of 362.50 g/mol. Its IUPAC name is dimethyl (1S,2R,7R,8S)-1-trimethylsilyloxytricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate.
| Compound Name | dimethyl (1S,2R,7R,8S)-1-trimethylsilyloxytricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 134889405 |
| Molecular Formula | C19H26O5Si |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | dimethyl (1S,2R,7R,8S)-1-trimethylsilyloxytricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(O[Si](C)(C)C)C=C[C@H]1[C@H]1CC=CC[C@H]12 |
| InChI | InChI=1S/C19H26O5Si/c1-22-17(20)15-13-10-11-19(24-25(3,4)5,16(15)18(21)23-2)14-9-7-6-8-12(13)14/h6-7,10-14H,8-9H2,1-5H3/t12-,13+,14-,19+/m1/s1 |
| InChIKey | BHXWBDSWZXIERT-QJNYJZHLSA-N |
| XLogP | 3.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|