C16H18O5 — CID 134889510
dimethyl (1S,2R,7R,8S)-1-hydroxytricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate (PubChem CID 134889510) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is dimethyl (1S,2R,7R,8S)-1-hydroxytricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate.
| Compound Name | dimethyl (1S,2R,7R,8S)-1-hydroxytricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 134889510 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | dimethyl (1S,2R,7R,8S)-1-hydroxytricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(O)C=C[C@H]1[C@H]1CC=CC[C@H]12 |
| InChI | InChI=1S/C16H18O5/c1-20-14(17)12-10-7-8-16(19,13(12)15(18)21-2)11-6-4-3-5-9(10)11/h3-4,7-11,19H,5-6H2,1-2H3/t9-,10+,11-,16+/m1/s1 |
| InChIKey | BVCPHAWOUUMXMH-IDYSPNNHSA-N |
| XLogP | 1.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|