About 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane]
1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane] (PubChem CID 134889491) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane].
Molecular Properties
| Compound Name | 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane] |
| PubChem CID | 134889491 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane] |
| SMILES | CC12CC1C21CCCCC1 |
| InChI | InChI=1S/C10H16/c1-9-7-8(9)10(9)5-3-2-4-6-10/h8H,2-7H2,1H3 |
| InChIKey | HGARVMIKOMYANV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane]?
The IUPAC name of 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane] (CID 134889491) is 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane].
What is the SMILES notation for 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane]?
The canonical SMILES for 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane] is CC12CC1C21CCCCC1.
What is the InChIKey of 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane]?
The InChIKey is HGARVMIKOMYANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-9-7-8(9)10(9)5-3-2-4-6-10/h8H,2-7H2,1H3.
What are the key properties of 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane]?
1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane] has a molecular weight of 136.24 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylspiro[bicyclo[1.1.0]butane-2,1'-cyclohexane] is sourced from PubChem (CID 134889491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).