C14H24O — CID 134889542
1-[(1S,2S)-2-ethenyl-1,3,3-trimethylcyclopentyl]but-3-en-2-ol (PubChem CID 134889542) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 1-[(1S,2S)-2-ethenyl-1,3,3-trimethylcyclopentyl]but-3-en-2-ol.
| Compound Name | 1-[(1S,2S)-2-ethenyl-1,3,3-trimethylcyclopentyl]but-3-en-2-ol |
|---|---|
| PubChem CID | 134889542 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1-[(1S,2S)-2-ethenyl-1,3,3-trimethylcyclopentyl]but-3-en-2-ol |
| SMILES | C=CC(O)C[C@]1(C)CCC(C)(C)[C@@H]1C=C |
| InChI | InChI=1S/C14H24O/c1-6-11(15)10-14(5)9-8-13(3,4)12(14)7-2/h6-7,11-12,15H,1-2,8-10H2,3-5H3/t11?,12-,14-/m0/s1 |
| InChIKey | XTFANFRDXNAWCF-WGIUUAEBSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|