About trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane
trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane (PubChem CID 134889678) has the molecular formula C13H28OSi
and a molecular weight of 228.45 g/mol. Its IUPAC name is trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane.
Molecular Properties
| Compound Name | trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane |
| PubChem CID | 134889678 |
| Molecular Formula | C13H28OSi |
| Molecular Weight | 228.45 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane |
| SMILES | CCCCC[C@@]1([Si](C)(C)C)O[C@H]1CCC |
| InChI | InChI=1S/C13H28OSi/c1-6-8-9-11-13(15(3,4)5)12(14-13)10-7-2/h12H,6-11H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | IFGCWPBSCKWGAX-STQMWFEESA-N |
| XLogP | 4.38 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane?
The IUPAC name of trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane (CID 134889678) is trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane.
What is the SMILES notation for trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane?
The canonical SMILES for trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane is CCCCC[C@@]1([Si](C)(C)C)O[C@H]1CCC.
What is the InChIKey of trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane?
The InChIKey is IFGCWPBSCKWGAX-STQMWFEESA-N. The full InChI is InChI=1S/C13H28OSi/c1-6-8-9-11-13(15(3,4)5)12(14-13)10-7-2/h12H,6-11H2,1-5H3/t12-,13-/m0/s1.
What are the key properties of trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane?
trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane has a molecular weight of 228.45 g/mol, XLogP of 4.38, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(2S,3S)-2-pentyl-3-propyloxiran-2-yl]silane is sourced from PubChem (CID 134889678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).