C18H35B — CID 134890689
2,3-dimethylbutan-2-yl-bis(4-methylpent-3-enyl)borane (PubChem CID 134890689) has the molecular formula C18H35B and a molecular weight of 262.29 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-bis(4-methylpent-3-enyl)borane.
| Compound Name | 2,3-dimethylbutan-2-yl-bis(4-methylpent-3-enyl)borane |
|---|---|
| PubChem CID | 134890689 |
| Molecular Formula | C18H35B |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.28 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-bis(4-methylpent-3-enyl)borane |
| SMILES | CC(C)=CCCB(CCC=C(C)C)C(C)(C)C(C)C |
| InChI | InChI=1S/C18H35B/c1-15(2)11-9-13-19(14-10-12-16(3)4)18(7,8)17(5)6/h11-12,17H,9-10,13-14H2,1-8H3 |
| InChIKey | SJAPZFRSJJOIES-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|