C19H39B — CID 134903763
3,3-dimethylbutan-2-yl-[(Z)-2,5-dimethylhex-3-en-3-yl]-(3-methylbutan-2-yl)borane (PubChem CID 134903763) has the molecular formula C19H39B and a molecular weight of 278.33 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-yl-[(Z)-2,5-dimethylhex-3-en-3-yl]-(3-methylbutan-2-yl)borane.
| Compound Name | 3,3-dimethylbutan-2-yl-[(Z)-2,5-dimethylhex-3-en-3-yl]-(3-methylbutan-2-yl)borane |
|---|---|
| PubChem CID | 134903763 |
| Molecular Formula | C19H39B |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.31 |
| IUPAC Name | 3,3-dimethylbutan-2-yl-[(Z)-2,5-dimethylhex-3-en-3-yl]-(3-methylbutan-2-yl)borane |
| SMILES | CC(C)/C=C(/B(C(C)C(C)C)C(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C19H39B/c1-13(2)12-18(15(5)6)20(16(7)14(3)4)17(8)19(9,10)11/h12-17H,1-11H3/b18-12+ |
| InChIKey | OMVSYIYQJPEDEB-LDADJPATSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|