About 5-oxooctan-4-yl carbamate
5-oxooctan-4-yl carbamate (PubChem CID 134890939) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is 5-oxooctan-4-yl carbamate.
Molecular Properties
| Compound Name | 5-oxooctan-4-yl carbamate |
| PubChem CID | 134890939 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 5-oxooctan-4-yl carbamate |
| SMILES | CCCC(=O)C(CCC)OC(N)=O |
| InChI | InChI=1S/C9H17NO3/c1-3-5-7(11)8(6-4-2)13-9(10)12/h8H,3-6H2,1-2H3,(H2,10,12) |
| InChIKey | HZNWXRGPJBGDBC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-oxooctan-4-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxooctan-4-yl carbamate?
The IUPAC name of 5-oxooctan-4-yl carbamate (CID 134890939) is 5-oxooctan-4-yl carbamate.
What is the SMILES notation for 5-oxooctan-4-yl carbamate?
The canonical SMILES for 5-oxooctan-4-yl carbamate is CCCC(=O)C(CCC)OC(N)=O.
What is the InChIKey of 5-oxooctan-4-yl carbamate?
The InChIKey is HZNWXRGPJBGDBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-3-5-7(11)8(6-4-2)13-9(10)12/h8H,3-6H2,1-2H3,(H2,10,12).
What are the key properties of 5-oxooctan-4-yl carbamate?
5-oxooctan-4-yl carbamate has a molecular weight of 187.24 g/mol, XLogP of 1.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxooctan-4-yl carbamate is sourced from PubChem (CID 134890939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).