About 5-oxooctan-4-yl thiophene-2-carboxylate
5-oxooctan-4-yl thiophene-2-carboxylate (PubChem CID 86024125) has the molecular formula C13H18O3S
and a molecular weight of 254.35 g/mol. Its IUPAC name is 5-oxooctan-4-yl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | 5-oxooctan-4-yl thiophene-2-carboxylate |
| PubChem CID | 86024125 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 5-oxooctan-4-yl thiophene-2-carboxylate |
| SMILES | CCCC(=O)C(CCC)OC(=O)c1cccs1 |
| InChI | InChI=1S/C13H18O3S/c1-3-6-10(14)11(7-4-2)16-13(15)12-8-5-9-17-12/h5,8-9,11H,3-4,6-7H2,1-2H3 |
| InChIKey | RUAGYALFQZMBMG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-oxooctan-4-yl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxooctan-4-yl thiophene-2-carboxylate?
The IUPAC name of 5-oxooctan-4-yl thiophene-2-carboxylate (CID 86024125) is 5-oxooctan-4-yl thiophene-2-carboxylate.
What is the SMILES notation for 5-oxooctan-4-yl thiophene-2-carboxylate?
The canonical SMILES for 5-oxooctan-4-yl thiophene-2-carboxylate is CCCC(=O)C(CCC)OC(=O)c1cccs1.
What is the InChIKey of 5-oxooctan-4-yl thiophene-2-carboxylate?
The InChIKey is RUAGYALFQZMBMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3S/c1-3-6-10(14)11(7-4-2)16-13(15)12-8-5-9-17-12/h5,8-9,11H,3-4,6-7H2,1-2H3.
What are the key properties of 5-oxooctan-4-yl thiophene-2-carboxylate?
5-oxooctan-4-yl thiophene-2-carboxylate has a molecular weight of 254.35 g/mol, XLogP of 3.44, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxooctan-4-yl thiophene-2-carboxylate is sourced from PubChem (CID 86024125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).