C13H16O3Se — CID 134891066
4,4-dimethyl-3-phenylselenonylcyclopent-2-en-1-ol (PubChem CID 134891066) has the molecular formula C13H16O3Se and a molecular weight of 299.23 g/mol. Its IUPAC name is 4,4-dimethyl-3-phenylselenonylcyclopent-2-en-1-ol.
| Compound Name | 4,4-dimethyl-3-phenylselenonylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 134891066 |
| Molecular Formula | C13H16O3Se |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4,4-dimethyl-3-phenylselenonylcyclopent-2-en-1-ol |
| SMILES | CC1(C)CC(O)C=C1[Se](=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O3Se/c1-13(2)9-10(14)8-12(13)17(15,16)11-6-4-3-5-7-11/h3-8,10,14H,9H2,1-2H3 |
| InChIKey | ZMXLYKCSLIIMSG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|