C15H12S2 — CID 134891207
2-(4-methylphenyl)sulfanyl-1-benzothiophene (PubChem CID 134891207) has the molecular formula C15H12S2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfanyl-1-benzothiophene.
| Compound Name | 2-(4-methylphenyl)sulfanyl-1-benzothiophene |
|---|---|
| PubChem CID | 134891207 |
| Molecular Formula | C15H12S2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-(4-methylphenyl)sulfanyl-1-benzothiophene |
| SMILES | Cc1ccc(Sc2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C15H12S2/c1-11-6-8-13(9-7-11)16-15-10-12-4-2-3-5-14(12)17-15/h2-10H,1H3 |
| InChIKey | ISVIDVVGHYGFGH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |