About lithium 4-(phenoxy)oxane
lithium 4-(phenoxy)oxane (PubChem CID 134892153) has the molecular formula C11H13LiO2
and a molecular weight of 184.16 g/mol. Its IUPAC name is lithium 4-(phenoxy)oxane.
Molecular Properties
| Compound Name | lithium 4-(phenoxy)oxane |
| PubChem CID | 134892153 |
| Molecular Formula | C11H13LiO2 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | lithium 4-(phenoxy)oxane |
| SMILES | [Li+].[c-]1ccc(OC2CCOCC2)cc1 |
| InChI | InChI=1S/C11H13O2.Li/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11;/h2-5,11H,6-9H2;/q-1;+1 |
| InChIKey | LTUAZVVLGQYIPK-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 4-(phenoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 4-(phenoxy)oxane?
The IUPAC name of lithium 4-(phenoxy)oxane (CID 134892153) is lithium 4-(phenoxy)oxane.
What is the SMILES notation for lithium 4-(phenoxy)oxane?
The canonical SMILES for lithium 4-(phenoxy)oxane is [Li+].[c-]1ccc(OC2CCOCC2)cc1.
What is the InChIKey of lithium 4-(phenoxy)oxane?
The InChIKey is LTUAZVVLGQYIPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O2.Li/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11;/h2-5,11H,6-9H2;/q-1;+1.
What are the key properties of lithium 4-(phenoxy)oxane?
lithium 4-(phenoxy)oxane has a molecular weight of 184.16 g/mol, XLogP of -0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 4-(phenoxy)oxane is sourced from PubChem (CID 134892153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).