C10H18NNaO2 — CID 134892439
sodium (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoate (PubChem CID 134892439) has the molecular formula C10H18NNaO2 and a molecular weight of 207.25 g/mol. Its IUPAC name is sodium (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoate.
| Compound Name | sodium (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 134892439 |
| Molecular Formula | C10H18NNaO2 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | sodium (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoate |
| SMILES | CC(C)[C@H](/N=C/C(C)(C)C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H19NO2.Na/c1-7(2)8(9(12)13)11-6-10(3,4)5;/h6-8H,1-5H3,(H,12,13);/q;+1/p-1/b11-6+;/t8-;/m0./s1 |
| InChIKey | CRXIWGOSDMDGQP-LIUVTHHLSA-M |
| XLogP | -2.12 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|