(2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid

C10H19NO2 — CID 86740762

IUPAC(2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid
SMILESCC(C)[C@H](/N=C/C(C)(C)C)C(=O)O
InChIInChI=1S/C10H19NO2/c1-7(2)8(9(12)13)11-6-10(3,4)5/h6-8H,1-5H3,(H,12,13)/b11-6+/t8-/m0/s1
InChIKeyYSTBVSDRCUVCQA-KIFNTFBYSA-N
MW185.27 g/mol
LogP2.21
Rot. Bonds3

About (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid

(2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid (PubChem CID 86740762) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid.

Molecular Properties

Compound Name(2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid
PubChem CID86740762
Molecular FormulaC10H19NO2
Molecular Weight185.27 g/mol
Exact Mass185.14
IUPAC Name(2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid
SMILESCC(C)[C@H](/N=C/C(C)(C)C)C(=O)O
InChIInChI=1S/C10H19NO2/c1-7(2)8(9(12)13)11-6-10(3,4)5/h6-8H,1-5H3,(H,12,13)/b11-6+/t8-/m0/s1
InChIKeyYSTBVSDRCUVCQA-KIFNTFBYSA-N
XLogP2.21
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.27
LogP ≤ 52.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid?
The IUPAC name of (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid (CID 86740762) is (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid.
What is the SMILES notation for (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid?
The canonical SMILES for (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid is CC(C)[C@H](/N=C/C(C)(C)C)C(=O)O.
What is the InChIKey of (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid?
The InChIKey is YSTBVSDRCUVCQA-KIFNTFBYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-7(2)8(9(12)13)11-6-10(3,4)5/h6-8H,1-5H3,(H,12,13)/b11-6+/t8-/m0/s1.
What are the key properties of (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid?
(2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid has a molecular weight of 185.27 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid is sourced from PubChem (CID 86740762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).