C10H19NO2 — CID 86740762
(2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid (PubChem CID 86740762) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid.
| Compound Name | (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 86740762 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (2S)-2-(2,2-dimethylpropylideneamino)-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](/N=C/C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H19NO2/c1-7(2)8(9(12)13)11-6-10(3,4)5/h6-8H,1-5H3,(H,12,13)/b11-6+/t8-/m0/s1 |
| InChIKey | YSTBVSDRCUVCQA-KIFNTFBYSA-N |
| XLogP | 2.21 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|