C10H17N3O2 — CID 91311364
3-methyl-2-[1-[(methylideneamino)methylimino]propan-2-ylideneamino]butanoic acid (PubChem CID 91311364) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-methyl-2-[1-[(methylideneamino)methylimino]propan-2-ylideneamino]butanoic acid.
| Compound Name | 3-methyl-2-[1-[(methylideneamino)methylimino]propan-2-ylideneamino]butanoic acid |
|---|---|
| PubChem CID | 91311364 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-methyl-2-[1-[(methylideneamino)methylimino]propan-2-ylideneamino]butanoic acid |
| SMILES | C=NCN=C/C(C)=N/C(C(=O)O)C(C)C |
| InChI | InChI=1S/C10H17N3O2/c1-7(2)9(10(14)15)13-8(3)5-12-6-11-4/h5,7,9H,4,6H2,1-3H3,(H,14,15)/b12-5?,13-8+ |
| InChIKey | GAEGGGCIVKDOML-UIVKRQBBSA-N |
| XLogP | 1.29 |
| TPSA | 74.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|