C7H13N2NaO3 — CID 100986811
sodium 2-amino-N-[(1S)-1-carboxy-2-methylpropyl]ethanimidate (PubChem CID 100986811) has the molecular formula C7H13N2NaO3 and a molecular weight of 196.18 g/mol. Its IUPAC name is sodium 2-amino-N-[(1S)-1-carboxy-2-methylpropyl]ethanimidate.
| Compound Name | sodium 2-amino-N-[(1S)-1-carboxy-2-methylpropyl]ethanimidate |
|---|---|
| PubChem CID | 100986811 |
| Molecular Formula | C7H13N2NaO3 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | sodium 2-amino-N-[(1S)-1-carboxy-2-methylpropyl]ethanimidate |
| SMILES | CC(C)[C@H](/N=C(\[O-])CN)C(=O)O.[Na+] |
| InChI | InChI=1S/C7H14N2O3.Na/c1-4(2)6(7(11)12)9-5(10)3-8;/h4,6H,3,8H2,1-2H3,(H,9,10)(H,11,12);/q;+1/p-1/t6-;/m0./s1 |
| InChIKey | NDVGZEPRKJRIPG-RGMNGODLSA-M |
| XLogP | -4.18 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|